Introduction：Basic information about Di-p-tolylamine CAS 620-93-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Di-p-tolylamine Basic information
| Product Name: | Di-p-tolylamine |
| Synonyms: | P,P'-DITLYLAMINE;P,P'-DITOLYLAMINE;4-methyl-n-(4-methylphenyl)-benzenamin;4,4-Dimethyldiphenylamine (DMDPA);DI-P-TOLYLAMINE;Di-para-tolylamine;Ditlylamine;DI-P-Tolyamine |
| CAS: | 620-93-9 |
| MF: | C14H15N |
| MW: | 197.28 |
| EINECS: | 210-659-8 |
| Product Categories: | Synthetic Intermediates;Organic Electronics and Photonics;Triphenylamine series;White Powder;Phenylamine Series;Synthetic Tools and Reagents;Pharmaceutical Intermediates;electronic;Amines;Diphenylamines (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research |
| Mol File: | 620-93-9.mol |
|
Di-p-tolylamine Chemical Properties
| Melting point | 78-82°C |
| Boiling point | 330 °C |
| density | 1.0514 (rough estimate) |
| refractive index | 1.6095 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chlorofrm (Slightly), Methanol (Slightly) |
| pka | 1.68±0.40(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C14H15N/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3 |
| InChIKey | RHPVVNRNAHRJOQ-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(C)C=C2)=CC=C(C)C=C1 |
| CAS DataBase Reference | 620-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4,4'-Dimethyldiphenylamine (620-93-9) |
Safety Information
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
Di-p-tolylamine Usage And Synthesis
| Chemical Properties | White crystalline powder |
| Uses | 4,4''-Dimethyldiphenylamine is a reagent used in the comparative studies of the analgesic and anti-inflammatory properties of N-phenylanthranilic acids and mefenamic acid, and the anti parasitic activities of some substituted diphenylamines. |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 40, p. 3349, 1975 DOI: 10.1021/jo00911a008 |
Di-p-tolylamine Preparation Products And Raw materials
| Raw materials | Acetamide, N,N-bis(4-methylphenyl)--->BIS(4-TOLYL)BORONIC ACID-->SODIUM TETRA(P-TOLYL)BORATE-->4-Bromotoluene-->4-Iodotoluene-->4-Tolylboronic acid-->4-Chlorotoluene-->p-Toluidine |
