Introduction:Basic information about CAS 71607-31-3|Di-p-toluoyl-D-tartaric acid monohydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-p-toluoyl-D-tartaric acid monohydrate |
|---|
| CAS Number | 71607-31-3 | Molecular Weight | 404.367 |
|---|
| Density | / | Boiling Point | 686ºC at 760 mmHg |
|---|
| Molecular Formula | C20H20O9 | Melting Point | 163-165 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 368.7ºC |
|---|
Names
| Name | Di-p-toluoyl-D-tartaric acid monohydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 686ºC at 760 mmHg |
|---|
| Melting Point | 163-165 °C(lit.) |
|---|
| Molecular Formula | C20H20O9 |
|---|
| Molecular Weight | 404.367 |
|---|
| Flash Point | 368.7ºC |
|---|
| Exact Mass | 404.110718 |
|---|
| PSA | 136.43000 |
|---|
| LogP | 2.15930 |
|---|
| InChIKey | FOTRUJUPLHRVNU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1.O |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) |
| (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid hydrate (1:1) |
| 2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid hydrate (1:1) |
| (2R,3R)-2,3-Bis[(4-methylbenzoyl)oxy]succinic acid hydrate (1:1) |
| Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, hydrate (1:1) |
| Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2R,3R)-, hydrate (1:1) |
| (+)-Di-1,4-toluoyl-D-tartaric acid monohydrate |
| Di-p-toluoyl-L-tartaric acid monohydrate |
| di-p-toluoyl-d-tartaric acid monohydrate |
| EINECS 251-132-2 |
| MFCD00149567 |