diSulfo-Cy3 amine CAS 2183440-43-7
Introduction:Basic information about diSulfo-Cy3 amine CAS 2183440-43-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
diSulfo-Cy3 amine Basic information
| Product Name: | diSulfo-Cy3 amine |
| Synonyms: | diSulfo-Cy3 amine;Sulfo CY3-NH2;Sulfo-Cyanine3 amine,Sulfo-Cy3 amine,Sulfo-Cyanine3 NH2;Sulfo-CY3.5-NH2 |
| CAS: | 2183440-43-7 |
| MF: | C36H50N4O7S2 |
| MW: | 714.94 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2183440-43-7.mol |
diSulfo-Cy3 amine Chemical Properties
| solubility | Soluble in water, alcohols, DMSO, DMF |
| form | Solid |
| color | Brown to dark brown |
| Appearance | Red solid |
| ex/em | 550/566 nm (PBS buffer) |
| ε(extinction coefficient) | 150000 L⋅mol−1⋅cm−1 |
| Φ(quantum yield) | 0.10 |
| InChIKey | ZVOZJQQPUBRDRD-UHFFFAOYSA-N |
| SMILES | C([N+]1=C(C(C)(C)C2=CC(S([O-])(=O)=O)=CC=C12)C=CC=C1N(C2=CC=C(S(O)(=O)=O)C=C2C1(C)C)C)CCCCC(=O)NCCCCCCN |
Safety Information
| Description | Sulfo-Cy3 amine is a water-soluble dye that reacts with electrophilic substances and is very photostable. The addition of the amine group makes the compound reactive towards carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. |
| Chemical Properties | Appearance: Red solid ex/em: 550/566 nm (PBS buffer) Extinction coefficient (ε): 150000 L??mol??1??cm??1 Quantum yield (Φ): 0.10 |
| Uses | Sulfo-Cy3 amine is a dye derivative of Cyanine 3 (Cy3) (HY-D0822) bearing an amine group. The sulfonate ion increases the water solubility of the compound, making it suitable for use in aqueous solutions. Cy3 is a fluorescent dye with a fluorescence spectrum typically in the green to orange wavelength range. The amine functionality of Sulfo-Cy3 amine can react with carboxyl groups to form covalent bonds. Sulfo-Cy3 amine can bind to biological molecules such as proteins and antibodies to track their location and dynamic changes in biological samples. |
| Abs/Em Maxima | 548/563 nm |
| Fluoresene quantum yield | 0.1 |
| Extinction Coefficient | 162000 |
| CF260 | 0.03 |
| CF280 | 0.06 |
