Introduction：Basic information about DL-INDOLE-3-LACTIC ACID CAS 1821-52-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
DL-INDOLE-3-LACTIC ACID Basic information
| Product Name: | DL-INDOLE-3-LACTIC ACID |
| Synonyms: | 3-INDOLE-LACTIC ACID;2-hydroxy-3-(1H-indol-3-yl)propanoate;3-(3-Indolyl)lactic Acid2-Hydroxy-3-(3-indolyl)propionic Acid;3-(3-INDOLYL)LACTIC ACID;3-[3-INDOLYL]-2-HYDROXYPROPANOIC ACID;DL-3-(3-INDOLYL)-LACTIC ACID;DL-3-INDOLELACTIC ACID;DL-B-3-INDOLELACTIC ACID |
| CAS: | 1821-52-9 |
| MF: | C11H11NO3 |
| MW: | 205.21 |
| EINECS: | 217-347-0 |
| Product Categories: | Indoles;Simple Indoles |
| Mol File: | 1821-52-9.mol |
|
DL-INDOLE-3-LACTIC ACID Chemical Properties
| Melting point | 145-146 °C(lit.) |
| Boiling point | 477.3±30.0 °C(Predicted) |
| density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.86±0.11(Predicted) |
| color | Pale Orange to Pale Purple |
| InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) |
| InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(O)CC1C2=C(NC=1)C=CC=C2 |
| CAS DataBase Reference | 1821-52-9(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| HS Code | 2933.99.9701 |
DL-INDOLE-3-LACTIC ACID Usage And Synthesis
| Uses | DL-Indole-3-lactic Acid is used as a reagent in the synthesis of 2-hydroxy-1-(1H-indol-3-yl)-4-methylpentan-3-one which has weak antibacterial activity against 16 bacterial strains, including Escherichia coli, Bacillus subtilis and Staphylococcus aureus. DL-Indole-3-lactic Acid is also used in the preparation of Monatin, a natural sweet peptidomimetic. |
| Definition | ChEBI: A hydroxy monocarboxylic acid that is lactic acid substituted by a 1H-indol-3-yl group at position 3. It is a metabolite of tryptophan. |
| in vivo | Indolelactic acid (gavage feeding, 10 μM, 5 μL, 5 days, C57BL/6 mice) benefits the immature intestine preferentially[4].
| Animal Model: | C57BL/6 mice[4] | | Dosage: | 10 μM, 5 μL | | Administration: | Gavage feeding, 5 days | | Result: | Upregulated the innate immune response genes in immature mouse intestine (C57-pup-ileum), with no effects on pup-colon or adult intestine.
|
|
| IC 50 | Human Endogenous Metabolite |
DL-INDOLE-3-LACTIC ACID Preparation Products And Raw materials
