Introduction：Basic information about D-Lysine CAS 923-27-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-Lysine Basic information
| Product Name: | D-Lysine |
| Synonyms: | D-2,6-DIAMINOHEXANOIC ACID;(R)-2,6-DIAMINOCAPROIC ACID;(R)-2,6-Diaminohexanoic acid;D-LYSINE;D-LYSIN;D-LysineBase;(2R)-2,6-diaminohexanoic acid;(R)-Lysine |
| CAS: | 923-27-3 |
| MF: | C6H14N2O2 |
| MW: | 146.19 |
| EINECS: | 213-091-9 |
| Product Categories: | Amino acid;chiral;Amino Acids |
| Mol File: | 923-27-3.mol |
|
D-Lysine Chemical Properties
| Melting point | 218 °C (dec.)(lit.) |
| Boiling point | 311.5±32.0 °C(Predicted) |
| density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: soluble |
| pka | 2.49±0.24(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| Optical Rotation | -25.2493°(C=1.0028g/ml 6N HCL) |
| Water Solubility | H2O: soluble |
| BRN | 1722530 |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | KDXKERNSBIXSRK-RXMQYKEDSA-N |
| SMILES | C(O)(=O)[C@@H](CCCCN)N |
| LogP | -0.734 (est) |
| CAS DataBase Reference | 923-27-3(CAS DataBase Reference) |
| EPA Substance Registry System | D-Lysine (923-27-3) |
Safety Information
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
D-Lysine Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | D-Lysine is the unnatural isomer of L-Lysine (L468895) that has the ability to reduce non-enzymatic glycation in vitro. D-Lysine also exists as polypeptide chains of poly-D-lysine, a nonspecific adhesion-promoting molecule that has the potential to be a polymeric drug carrier. |
| Uses | D-Lysine is used as a component of a wide array of polymers (poly-D-lysine), surfactants and biofilms to confer a positive (cationic) charge. |
| Definition | ChEBI: D-lysine is the D-enantiomer of the alpha-amino acid lysine. It has a role as a bacterial metabolite and a fungal metabolite. It is a lysine and a D-alpha-amino acid. It is a conjugate base of a D-lysinium(1+). It is a conjugate acid of a D-lysinate. It is an enantiomer of a L-lysine. |
| in vivo | D-Lysine (400 mg/kg; i.v. or p.o.) dose not result in significantly greater inhibition of kidney uptake of '"In-DTPAOC, and Oral administration of D-lysine also reduces kidney uptake in rats[1]. |
| IC 50 | Human Endogenous Metabolite |
D-Lysine Preparation Products And Raw materials
| Preparation Products | D-alpha-Amino-epsilon-caprolactam |
