Introduction：Basic information about D-LYXOSE CAS 1114-34-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-LYXOSE Basic information
| Product Name: | D-LYXOSE |
| Synonyms: | D(-)LYXOSE extrapure;D-manno-Pentose;LYXOSE, D-(-)-(RG);D-Lyxose ,99%;NSC 224430;(2S,3S,4R)-2,3,4,5-Tetrahydroxypentanal;aldehydo-D-lyxose;D-LYXOPYRANOSE |
| CAS: | 1114-34-7 |
| MF: | C5H10O5 |
| MW: | 150.13 |
| EINECS: | 214-212-8 |
| Product Categories: | Carbohydrates & Derivatives;CARBOHYDRATE;13C & 2H Sugars;Basic Sugars (Mono & Oligosaccharides);Biochemistry;Lyxose;Sugars;Dextrins、Sugar & Carbohydrates;aldehydes;Glycon Biochem |
| Mol File: | 1114-34-7.mol |
|
D-LYXOSE Chemical Properties
| Melting point | 108-112 °C(lit.) |
| alpha | D20 +5.5° -14.0° (c = 0.82 in water) |
| Boiling point | 191.65°C (rough estimate) |
| density | 1.545 |
| refractive index | 1.3920 (estimate) |
| storage temp. | Refrigerator |
| solubility | H2O: 50 mg/mL, clear, colorless |
| pka | 12.46±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Optical Rotation | [α]25/D 13.8°, c = 4 in H2O |
| Water Solubility | Water (Slightly) |
| Sensitive | Hygroscopic |
| Merck | 14,5641 |
| BRN | 1723083 |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5?/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-AGQMPKSLSA-N |
| SMILES | O[C@@H]1COC(O)[C@@H](O)[C@H]1O |
| LogP | -2.390 (est) |
| CAS DataBase Reference | 1114-34-7(CAS DataBase Reference) |
| EPA Substance Registry System | D-Lyxose (1114-34-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
D-LYXOSE Usage And Synthesis
| Chemical Properties | White to slightly yellow crystalline powder |
| Uses | D-LYXOSE is a useful carbohydrate synthon. |
| Uses | D-Lyxose is a C’-2 epimer of D-Xylose (X750750). It is a monosaccharide and a reducing carbohydrate present in maple syrup. It is used in molecular modeling calculations in the study of drug binding and recognition in relation to aldose reductase. |
D-LYXOSE Preparation Products And Raw materials
| Preparation Products | 2,3-O-ISOPROPYLIDENE-L-RIBONIC ACID-1,4-LACTONE(WX640385)-->D-(-)-THREOSE-->2,3-O-Isopropylidene-D-lyxono-1,4-lactone-->D(+)-Xylose |
