Introduction：Basic information about D-Norleucine CAS 327-56-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-Norleucine Basic information
| Product Name: | D-Norleucine |
| Synonyms: | D-Norleucine;H-D-2-AMINOCAPROIC ACID;H-D-ACPO(2)-OH;H-D-AHX(2)-OH;H-D-NLE-OH;H-D-NORLEUCINE;D-2-AMINO CAPROIC ACID;D-2-AMINOHEXANOIC ACID |
| CAS: | 327-56-0 |
| MF: | C6H13NO2 |
| MW: | 131.17 |
| EINECS: | 206-320-9 |
| Product Categories: | Leucine [Leu, L];Amino Acids;AMINO ACIDS;Amino Acid Derivatives |
| Mol File: | 327-56-0.mol |
|
D-Norleucine Chemical Properties
| Melting point | ≥300 °C |
| alpha | [α]D20 -23.0～-25.0゜ (c=4, HCl) |
| Boiling point | 234.0±23.0 °C(Predicted) |
| density | 1.1720 (estimate) |
| refractive index | -23 ° (C=4.5, 6mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.55±0.24(Predicted) |
| form | powder to crystal |
| color | White |
| Water Solubility | 15.75g/L(19 ºC) |
| Merck | 14,6706 |
| BRN | 1721749 |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | LRQKBLKVPFOOQJ-RXMQYKEDSA-N |
| SMILES | C(O)(=O)[C@@H](CCCC)N |
| CAS DataBase Reference | 327-56-0(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
D-Norleucine Usage And Synthesis
| Chemical Properties | white to off-white crystalline powder or flakes |
| Uses | D-Norleucine is used for the synthesis of Thailandepsin B, a bicyclic depsipeptide histone deacetylase inhibitor. |
| Definition | ChEBI: D-norleucine is the D-enantiomer of 2-aminohexanoic acid. It is an enantiomer of a L-norleucine. It is a tautomer of a D-norleucine zwitterion. |
| Purification Methods | Crystallise norleucine from water or aqueous MeOH. [Huffman & Ingersoll J Am Chem Soc 73 3366 1951, Beilstein 4 III 1386, 4 IV 2628.] |
D-Norleucine Preparation Products And Raw materials
| Preparation Products | DL-Norleucine-->D-Norleucine, 2-(aminomethyl)- (9CI)-->AC-D-NLE-OH |
