Introduction：Basic information about Eledoisin CAS 69-25-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Eledoisin Basic informationDescription Background
| Product Name: | Eledoisin |
| Synonyms: | eledonepeptide;ELEDOISIN;GLP-PRO-SER-LYS-ASP-ALA-PHE-ILE-GLY-LEU-MET-NH2;5-oxo-l-prolyl-l-prolyl-l-seryl-l-lysyl-l-aspartyl-l-alanyl-l-phenylalanyl-l-isoleucylglycyl-l-leucyl-l-methioninamide;PYR-PRO-SER-LYS-ASP-ALA-PHE-ILE-GLY-LEU-MET-NH2;PYR-PSKDAFIGLM-NH2;PGLU-PRO-SER-LYS-ASP-ALA-PHE-ILE-GLY-LEU-MET-NH2;ELEDOSIN |
| CAS: | 69-25-0 |
| MF: | C54H85N13O15S |
| MW: | 1188.4 |
| EINECS: | 251-228-4 |
| Product Categories: | proteins;Peptide |
| Mol File: | 69-25-0.mol |
|
Eledoisin Chemical Properties
| Melting point | 230 °C (decomp) |
| Boiling point | 1618.1±65.0 °C(Predicted) |
| density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: 15 mg/ml; DMSO: 20 mg/ml; DMSO:PBS (pH 7.2) (1:20): 0.04 mg/ml |
| form | A crystalline solid |
| pka | 4.19±0.10(Predicted) |
| color | White to off-white |
| Optical Rotation | -4422 (95% Acetic Acid) |
| Sequence | {Glp}-Pro-Ser-Lys-Asp-Ala-Phe-Ile-Gly-Leu-Met-NH2 |
| InChIKey | AYLPVIWBPZMVSH-UHFFFAOYSA-N |
| SMILES | C(C1NC(=O)CC1)(N1CCCC1C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NC(CC(O)=O)C(=O)NC(C)C(=O)NC(C(=O)NC(C(C)CC)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(C(=O)N)CCSC)CC1C=CC=CC=1)=O |
Safety Information
| WGK Germany | 3 |
| RTECS | JX8688000 |
| HS Code | 3504009000 |
Eledoisin Usage And Synthesis
| Uses | Eledoisin (Eledone peptide) is a specific agonist of NK2 and NK3 receptors. |
| Definition | ChEBI: Eledoisin is a peptide. |
| in vivo | Eledoisin (Eledone peptide; 0.1-1 nmol/kg) injected into rats produces a biphasic cardiovascular response that consists of an initial fall of systemic blood pressure (8-15 mm Hg) followed by a rise (20-22 mm Hg). Intracerebroventricular injection of Eledoisin produces an enhancement of grooming and scratching behavior in mice[2]. |
| IC 50 | NK2; NK3 |
| Description | Eledoisin’s molecular weight is 1188.4 having an amino acid sequence of Glp-Pro-Ser-Lys-Asp-Ala-Phe-Ile-Gly-Leu-Met-NH2 and a molecular formula of C54H85N13O15S. |
| Background | Eledoisin is an undecapeptide formed in the venom gland of several species of octopuses and is used as a vasodilator and a contraction agent of extravascular smooth muscle. |
| References | [1] Lippe C, et al. Eledoisin and Kassinin, but not Enterokassinin, stimulate ion transport in frog skin. Peptides. 2004 Nov;25(11):1971-5. DOI:10.1016/j.peptides.2004.06.014
[2] Severini C, et al. The tachykinin peptide family. Pharmacol Rev. 2002 Jun;54(2):285-322. DOI:10.1124/pr.54.2.285 |
Eledoisin Preparation Products And Raw materials
