Introduction：Basic information about Enoximone CAS 77671-31-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Enoximone Basic information
| Product Name: | Enoximone |
| Synonyms: | ENOXIMONE;2H-Imidazol-2-one, 1,3-dihydro-4-methyl-5-(4-(methylthio)benzoyl)-;Fenoximone;MDL-17043;Pedane;Perfan;RMI-17043;4-methyl-5-(4-methylsulfanylbenzoyl)-1,3-dihydroimidazol-2-one |
| CAS: | 77671-31-9 |
| MF: | C12H12N2O2S |
| MW: | 248.3 |
| EINECS: | |
| Product Categories: | APIs;API |
| Mol File: | 77671-31-9.mol |
|
Enoximone Chemical Properties
| Melting point | 255-258°C |
| density | 1.33 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 28 mg/mL, soluble |
| pka | 10.37±0.70(Predicted) |
| form | solid |
| color | light yellow |
| InChI | 1S/C12H12N2O2S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(17-2)6-4-8/h3-6H,1-2H3,(H2,13,14,16) |
| InChIKey | ZJKNESGOIKRXQY-UHFFFAOYSA-N |
| SMILES | CSc1ccc(cc1)C(=O)C2=C(C)NC(=O)N2 |
| CAS DataBase Reference | 77671-31-9(CAS DataBase Reference) |
Safety Information
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
Enoximone Usage And Synthesis
| Description | Enoximone is a phosphodiesterase inhibitor indicated for selective use as acardiostimulant in heart transplant patient maintenance. It is currently being investigatedfor other indications including acute congestive heart failure. |
| Chemical Properties | Crystallized from isopropyl alcohol-water, melting point 255-258°C (decomposition). |
| Originator | Merrell Dow (USA) |
| Uses | Enoximone is a phosphodiesterase inhibitor used in the treatment of congestive heart failure and is selective to phosphodiesterase 3. Potent PDE-3 inhibitor. |
| Definition | ChEBI: Enoximone is an aromatic ketone. |
| Brand name | Perfan IV |
| Biological Activity | Inhibitor of type III phosphodiesterase (PDE3). Increases intracellular cyclic AMP (cAMP) concentrations and enhances myocardial contractility. Also induces concentration-dependent vasodilation in vitro . |
| Biochem/physiol Actions | Selective phosphodiesterase III (PDE3) inhibitor. Prevents the degradation of cAMP by PDE. Increased cAMP results in enhanced contractility of the heart. |
| storage | Store at +4°C |
Enoximone Preparation Products And Raw materials
| Raw materials | Ethyl acetate-->NITROUS ACID |
