Introduction:Basic information about Estradiene dione-3-keta CAS 5571-36-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Estradiene dione-3-keta Basic information
| Product Name: | Estradiene dione-3-keta |
| Synonyms: | ESTRADIENE DIONE-3-KETA;ESTRADIENE DIONE-3-KETAL;cyclic-3-(1,2-ethanediyl acetal)-estra-5(10),9(11)-dien-3,17-dione;3-ETHYLENE DIOXY-17-OXO-13-METHYL ESTRA-5(10)9(11)-DIENE;3-ETHYLENE DIOXY-17-OXO ESTRA-5(10), 9(11)-DIENE;3-Ethylenedioxy-estra-5(10),9(11)-diene-17-one;Estradiene;-ETHYLENEDIOXY-ESTRA-5(10), 9(11)-DIEN-17-ONE |
| CAS: | 5571-36-8 |
| MF: | C20H26O3 |
| MW: | 314.43 |
| EINECS: | 427-230-8 |
| Product Categories: | Intermediates;Intermediates & Fine Chemicals;Various Intermediates;Pharmaceuticals;Other APIs;5571-36-8 |
| Mol File: | 5571-36-8.mol |
|
Estradiene dione-3-keta Chemical Properties
| Melting point | 152-154°C |
| Boiling point | 488.1±45.0 °C(Predicted) |
| density | 1.20±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly, Heated, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | White to Light Yellow |
| Optical Rotation | Consistent with structure |
| Water Solubility | 903μg/L at 25℃ |
| InChI | InChI=1/C20H26O3/c1-19-8-6-15-14-7-9-20(22-10-11-23-20)12-13(14)2-3-16(15)17(19)4-5-18(19)21/h6,16-17H,2-5,7-12H2,1H3/t16-,17+,19+/s3 |
| InChIKey | XUOQKQRMICQUQC-GDJQEYATNA-N |
| SMILES | C[C@@]12C(CC[C@@]1([H])[C@]1([H])CCC3CC4(OCCO4)CCC=3C1=CC2)=O |&1:1,5,7,r| |
| LogP | 4.74 |
Safety Information
| RIDADR | 3077 |
| HS Code | 2937.23.5050 |
| HazardClass | 9 |
| PackingGroup | III |
Estradiene dione-3-keta Usage And Synthesis
| Uses | 3-Ketal is used as an intermediate for mifepristone; it is also used as an anti-progestin and anti-glucocorticoid antagonist, steroid spiroxazole. |
| Chemical Properties | Off-White Solid |
Estradiene dione-3-keta Preparation Products And Raw materials
| Preparation Products | Gestrinone-->Altrenogest |