Introduction：Basic information about FARNESAL CAS 19317-11-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
FARNESAL Basic information
| Product Name: | FARNESAL |
| Synonyms: | 10-dodecatrienal,3,7,11-trimethyl-6;3,7,11-trimethyl-dodeca-2,6,10-trienal;6,10-Dodecatrienal,3,7,11-trimethyl-2;farnesal,mixtureofisomers;TIMTEC-BB SBB007716;FARNESAL;FARNESONE;3,7,11-TRIMETHYL-2,6,10-DODECATRIENAL |
| CAS: | 19317-11-4 |
| MF: | C15H24O |
| MW: | 220.35 |
| EINECS: | 242-957-9 |
| Product Categories: | |
| Mol File: | 19317-11-4.mol |
|
FARNESAL Chemical Properties
| Boiling point | 126-129 °C3.5 mm Hg(lit.) |
| density | 0.909 g/mL at 25 °C(lit.) |
| FEMA | 4019 | 3,7,11-TRIMETHYL-2,6,10-DODECATRIENAL |
| refractive index | n20/D >1.4920(lit.) |
| Fp | >230 °F |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Oil |
| color | Pale Yellow to Yellow |
| Odor | floral minty |
| Odor Type | floral |
| biological source | synthetic |
| JECFA Number | 1228 |
| BRN | 1723427 |
| Stability: | Light Sensitive |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| InChIKey | YHRUHBBTQZKMEX-YFVJMOTDSA-N |
| SMILES | [H]C(=O)\C=C(/C)CC\C=C(/C)CC\C=C(/C)C |
| LogP | 5.20 |
| EPA Substance Registry System | 2,6,10-Dodecatrienal, 3,7,11-trimethyl- (19317-11-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| F | 1-10 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
FARNESAL Usage And Synthesis
| Occurrence | Reportedly present in tomato, ginger and cardamom. |
| Uses | Farnesone is s useful building block for organic synthesis |
| Uses | Farnesal was used in the synthesis of sesquiterpene nanaimoal. |
| Preparation | Reportedly prepared in a patented process by reaction of farnesol with diethyl ether in the presence of a catalyst. |
| Definition | ChEBI: Farnesal is a farnesane sesquiterpenoid and an enal. |
| Synthesis Reference(s) | Synthetic Communications, 20, p. 3125, 1990 DOI: 10.1080/00397919008051535 |
| General Description | Farnesal has been reported as specific lipid substrate for aldo-keto reductase 1B10 (AKR1B10). The incubation of farnesol with the protoplast of Botryococcus braunii B race strain leads to the formation of farnesal and 3-hydroxy-2,3-dihydrofarnesal. |
FARNESAL Preparation Products And Raw materials
