Introduction：Basic information about Fmoc-D-1-Naphthylalanine CAS 138774-93-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Fmoc-D-1-Naphthylalanine Basic information
| Product Name: | Fmoc-D-1-Naphthylalanine |
| Synonyms: | FMoc-D-1-Nal-OH FMoc-3-(1-Naphthyl)-D-Alanine;(2R)-2-{[(9H-fluoren-9-ylMethoxy)carbonyl]aMino}-3-(1-naphthyl)propanoic acid;Fmoc-3-(1-Naphthyl)-D-alainine;Fmoc-3-(1-naphthyl)-D-alanine≥ 99% (HPLC);FMOC-(R)-2-AMINO-3-(NAPHTHALEN-1-YL)PROPANOIC ACID;FMOC-BETA-(1-NAPHTHYL)-D-ALANINE;FMOC-3-(1-NAPHTHYL)-D-ALA;N-FMoc-3-(1-naphthyl)-D-alanine, 98% |
| CAS: | 138774-93-3 |
| MF: | C28H23NO4 |
| MW: | 437.49 |
| EINECS: | |
| Product Categories: | Fmoc-Amino acid series;Peptide;a-amino;Alanine [Ala, A];Unusual Amino Acids;Phenylalanine analogs and other aromatic alpha amino acids;Amino Acid Derivatives;Amino Acids |
| Mol File: | 138774-93-3.mol |
|
Fmoc-D-1-Naphthylalanine Chemical Properties
| Boiling point | 690.7±50.0 °C(Predicted) |
| density | 1.296±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.77±0.30(Predicted) |
| color | White to off-white |
| BRN | 9160026 |
| Major Application | peptide synthesis |
| InChIKey | ORWNVJDLEMVDLV-JKXWNSIXNA-N |
| SMILES | C1(COC(=O)N[C@@H](C(=O)O)CC2C=CC=C3C=CC=CC=23)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| |
| CAS DataBase Reference | 138774-93-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
Fmoc-D-1-Naphthylalanine Usage And Synthesis
| Chemical Properties | White powder |
| Uses | Fmoc-d-1-naphthylalanine, is an amino acid derivative used in chemical synthesis and peptide chemistry. |
| reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
Fmoc-D-1-Naphthylalanine Preparation Products And Raw materials
