Introduction：Basic information about FORSYTHIN CAS 487-41-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
FORSYTHIN Basic information
| Product Name: | FORSYTHIN |
| Synonyms: | FORSYTHIN PHILLYRIN;dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2-methoxyphenyl;Phillyroside;Phyllyrin;β-D-Glucopyranoside,4-[(1S,3aR,4R,6aR)-4-(3,4-;(1S)-1β-[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]-4α-(3,4-dimethoxyphenyl)-3aβ,4,6,6aβ-tetrahydro-1H,3H-furo[3,4-c]furan;PHEOPHYTHIN A (SH);Chionanthin |
| CAS: | 487-41-2 |
| MF: | C27H34O11 |
| MW: | 534.55 |
| EINECS: | |
| Product Categories: | Piperidines ,Homopiperidines;Inhibitors;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Miscellaneous Natural Products |
| Mol File: | 487-41-2.mol |
|
FORSYTHIN Chemical Properties
| Melting point | approximate 157℃ |
| Boiling point | 730.4±60.0 °C(Predicted) |
| density | 1.361±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.81±0.70(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | food and beverages |
| InChIKey | KFFCKOBAHMGTMW-LGQRSHAYSA-N |
| SMILES | O[C@@H]([C@H](O)[C@@H](CO)O1)[C@@H](O)[C@@H]1OC(C=C2)=C(OC)C=C2[C@H]3OC[C@]4([H])[C@@H](OC[C@@]43[H])C5=CC(OC)=C(OC)C=C5 |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
FORSYTHIN Usage And Synthesis
| Chemical Properties | White crystalline powder, easily soluble in benzene, ether and chloroform, derived from Forsythia suspense, Rehmannia glutinosa and Campanula fruit. |
| Uses | Phillyrin is a natural lignan compound attenuating tumor necrosis factor secreted from macrophages, that play an inportant role in adipocyte dysfunctions. Anti-obesity. |
| IC 50 | CYP1; CYP2 |
FORSYTHIN Preparation Products And Raw materials
| Preparation Products | (+)-SYLVATESMIN |
