Ganoderenic acid C CAS 100665-42-7
Introduction:Basic information about Ganoderenic acid C CAS 100665-42-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Ganoderenic acid C Basic information
| Product Name: | Ganoderenic acid C |
| Synonyms: | (20E)-3β,7β,15α-Trihydroxy-11,23-dioxo-5α-lanosta-8,20(22)-dien-26-oic acid;(3beta,7beta,15alpha,20E)-3,7,15-Trihydroxy-11,23-dioxo-lanosta-8,20(22)-dien-26-oic acid;Ganoderenic acid c;Lanosta-8,20(22)-dien-26-oicacid, 3,7,15-trihydroxy-11,23-dioxo-, (3b,7b,15a,20E)-;Lanosta-8,20(22)-dien-26-oic acid, 3,7,15-trihydroxy-11,23-dioxo-, (3β,7β,15α,20E)-;Ganodermic acid C;(E)-2-Methyl-4-oxo-6-((3S,5R,7S,10S,13R,14R,15S,17R)-3,7,15-trihydroxy-4,4,10,13,14-pentamethyl-11-oxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)hept-5-enoic acid |
| CAS: | 100665-42-7 |
| MF: | C30H44O7 |
| MW: | 516.67 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 100665-42-7.mol |
Ganoderenic acid C Chemical Properties
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| InChIKey | DIEUZIPSDUGWLD-QYHYFQJXNA-N |
| SMILES | [C@@H]1(O)C(C2[C@](C)(CC1)C1=C([C@]3([C@@](CC1=O)(C)[C@@H](/C(/C)=C/C(=O)CC(C)C(O)=O)C[C@@H]3O)C)[C@@H](O)C2)(C)C |&1:0,4,10,11,16,29,32,r| |
Safety Information
| Description | Ganoderenic acid C is a triterpene that has been found in G. lucidum. It is cytotoxic to H460 cancer cells (IC50 = 93 μM). |
| Uses | Ganoderenic acid C (GDC) is a triterpenoid extracted from Ganoderma lucidum (GL). GDC can be used to establish HPLC-DAD fingerprints of GL for quality control of GL products. Studies have shown that GDC has anticancer and anti-inflammatory effects. GDC binds to enzymes involved in the synthesis of DNA, RNA and proteins and can inhibit the activity of cancer cells. GDC also inhibits the production of prostaglandins, which leads to an anti-inflammatory effect. |
| Definition | ChEBI: Ganoderenic acid C is a triterpenoid. |
