Introduction：Basic information about GARDENIN B CAS 2798-20-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
GARDENIN B Basic information
| Product Name: | GARDENIN B |
| Synonyms: | GARDENIN B;4',6,7,8-Tetramethoxy-5-hydroxyflavone;5-Hydroxy-4',6,7,8-tetramethoxyflavone;5-O-Desmethyltangeretin;5-DesMethyltangeretin;5-O-DeMethyltangeretin;Demethyltangeretin;Demethyltangeretin/Gardenin B |
| CAS: | 2798-20-1 |
| MF: | C19H18O7 |
| MW: | 358.34 |
| EINECS: | |
| Product Categories: | Miscellaneous Natural Products |
| Mol File: | 2798-20-1.mol |
|
GARDENIN B Chemical Properties
| Melting point | 180-181℃ |
| Boiling point | 582.0±50.0 °C(Predicted) |
| density | 1.309±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in methan |
| form | powder |
| pka | 6.83±0.40(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3 |
| InChIKey | LXEVSYZNYDZSOB-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C=C2)OC2=C(OC)C(OC)=C(OC)C(O)=C2C(=O)C=1 |
Safety Information
GARDENIN B Usage And Synthesis
| Uses | food and beverages |
| Definition | ChEBI: A tetramethoxyflavone that is tangeretin in which the methoxy group at position 5 has been replaced by a hydroxy group. |
GARDENIN B Preparation Products And Raw materials
| Raw materials | NSC75340-->4H-1-Benzopyran-4-one, 2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxy--->Pedunculin-->(E)-1-(6-Hydroxy-2,3,4-trimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one-->4-Benzyloxybenzaldehyde-->Tangeretin-->SCUTELLAREIN TETRAMETHYL ETHER-->5,4''-DIHYDROXY-6,7,8-TRIMETHOXYFLAVONE-->salvigenin-->1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)ethanone-->Dimethyl sulfate |
