Introduction：Basic information about Isoimperatorin CAS 482-45-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Isoimperatorin Basic information
| Product Name: | Isoimperatorin |
| Synonyms: | Isoimperatorin, 98%, from Angelica dahurica;Isoimperatorin 482-45-1;ISOIMPERATORIN;4-PRENYLOXYPSORALEN;4-(3-Methyl-but-2-enyloxy-furo[3,2-g]chromen-7-one;ISOIMPERATORIN(P);Isomperatorin;4-(3-Methylbut-2-enoxy)furo[3,2-g]chromen-7-one |
| CAS: | 482-45-1 |
| MF: | C16H14O4 |
| MW: | 270.28 |
| EINECS: | 801-715-8 |
| Product Categories: | Miscellaneous Natural Products;Inhibitors;chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Heterocycles;Heterocyclic Compounds |
| Mol File: | 482-45-1.mol |
|
Isoimperatorin Chemical Properties
| Melting point | 107-111°C |
| Boiling point | 448.3±45.0 °C(Predicted) |
| density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly |
| form | Solid |
| color | White to Pale Yellow |
| BRN | 1291723 |
| Major Application | food and beverages |
| InChI | 1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | IGWDEVSBEKYORK-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(C(OCC=C(C)C)=C(C=CO2)C2=C3)=C3O1 |
| LogP | 3.495 (est) |
| CAS DataBase Reference | 482-45-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 7H-furo[3,2-g][1]benzopyran-7-one, 4-[(3-methyl-2-butenyl)oxy]-(482-45-1) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LV1513000 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 482-45-1(Hazardous Substances Data) |
Isoimperatorin Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | Anti-inflammatory. Effect on proliferation. |
| Definition | ChEBI: A member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 5. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. |
| IC 50 | AChE |
Isoimperatorin Preparation Products And Raw materials
| Raw materials | Bergapten-->BERGAPTOL-->3,3-Dimethylallyl bromide |
