Introduction：Basic information about Leucocrystal Violet CAS 603-48-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Leucocrystal Violet Basic information
| Product Name: | Leucocrystal Violet |
| Synonyms: | 4,4',4''-Tris(dimethylamino)triphenylmethane;4,4',4''-Tris(N,N-dimethylaminophenyl)methane;Aniline, 4,4',4''-methylidynetris*N,N-dimethyl-;Aniline, 4,4',4''-methylidynetris[N,N-dimethyl-;Benzenamine, 4,4',4''-methylidynetris*N,N-dimethyl-;Benzenamine, 4,4',4''-methylidynetris[N,N-dimethyl-;C.I. Basic Violet 3, leuco;Leucomethyl green |
| CAS: | 603-48-5 |
| MF: | C25H31N3 |
| MW: | 373.53 |
| EINECS: | 210-043-9 |
| Product Categories: | Intermediates of Dyes and Pigments;Amines, Aromatics, Metabolites & Impurities;Leucocrystal Violet;Amines;Aromatics;Metabolites & Impurities;Organics |
| Mol File: | 603-48-5.mol |
|
Leucocrystal Violet Chemical Properties
| Melting point | 175-177 °C(lit.) |
| Boiling point | 492.75°C (rough estimate) |
| density | 1.1857 (rough estimate) |
| vapor pressure | 0-0Pa at 10-30℃ |
| refractive index | 1.6270 (estimate) |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 5.93±0.24(Predicted) |
| color | White to light gray to slightly lavender |
| ε(extinction coefficient) | ≥700 at 257-263nm |
| λmax | 260 nm |
| Stability: | Stable, but light and air sensitive. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing
hematology
histology |
| InChI | 1S/C25H31N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18,25H,1-6H3 |
| InChIKey | OAZWDJGLIYNYMU-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
| LogP | 5.9 |
| CAS DataBase Reference | 603-48-5(CAS DataBase Reference) |
| NIST Chemistry Reference | P,p',p''-methylidynetris(n,n-dimethylaniline)(603-48-5) |
| EPA Substance Registry System | Leucogentian violet (603-48-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
Leucocrystal Violet Usage And Synthesis
| Chemical Properties | lavender-coloured powder |
| Uses | A metabolite of Gentian Violet in seafood products. Dyes and metabolites, Environmental Testing |
| Definition | ChEBI: Leucocrystal Violet is a benzenoid aromatic compound. |
| Biological Activity | Leucocrystal Violet (LCV) is a cationic triarylmethane dye. LCV is a reduced form of gentian violet (crystal violet) and thus, it is colorless. It has an affinity for both cellulosic and proteinaceous materials. LCV and hydrogen peroxide react with the hemoglobin in blood and turn the blood impression to purple/violet color. Therefore, the dye is widely used to stain blood residue on both porous and non-porous materials. |
Leucocrystal Violet Preparation Products And Raw materials
| Preparation Products | 4,4'-Bis(dimethylamino)thiobenzophenone |
