Introduction：Basic information about Leucoson CAS 1950-36-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Leucoson Basic information
| Product Name: | Leucoson |
| Synonyms: | LEUCOGEN;Leucoson;4-Carboxy-α-phenyl-2-thiazolidineacetic acid 2-ethyl ester;Leukogen;2-(2-ethoxy-2-keto-1-phenyl-ethyl)thiazolidine-4-carboxylic acid;2-(2-ethoxy-2-oxo-1-phenyl-ethyl)-1,3-thiazolidine-4-carboxylic acid;2-(2-ethoxy-2-oxo-1-phenylethyl)-1,3-thiazolidine-4-carboxylic acid;2-Thiazolidineaceticacid,4-carboxy-.alpha.-phenyl-,2-ethylester |
| CAS: | 1950-36-3 |
| MF: | C14H17NO4S |
| MW: | 295.35 |
| EINECS: | |
| Product Categories: | API |
| Mol File: | 1950-36-3.mol |
|
Leucoson Chemical Properties
| Melting point | 169-170 °C (decomp) |
| Boiling point | 479.5±45.0 °C(Predicted) |
| density | 1.292±0.06 g/cm3(Predicted) |
| pka | 1.96±0.40(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C14H17NO4S/c1-2-19-14(18)11(9-6-4-3-5-7-9)12-15-10(8-20-12)13(16)17/h3-7,10-12,15H,2,8H2,1H3,(H,16,17) |
| InChIKey | XDBMTQVSHNQIFU-UHFFFAOYSA-N |
| SMILES | C1(SCC(C(=O)O)N1)C(C(=O)OCC)C1C=CC=CC=1 |
Safety Information
Leucoson Usage And Synthesis
| Uses | Leyk is a a biochemical assay reagent[1]. |
| References | [1] HARUNA H, et al. [THE EFFECT OF LEYK (CYSTEINE DERIVATIVE) ON THE RADIATION INJURY]. Nihon Igaku Hoshasen Gakkai Zasshi. 1963 Sep;23:685-97. PMID:14085593 |
Leucoson Preparation Products And Raw materials
