Introduction：Basic information about LUMICHROME CAS 1086-80-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
LUMICHROME Basic information
| Product Name: | LUMICHROME |
| Synonyms: | LUMICHROME;7,8-Dimethylbenzo[g]pteridine-2,4-diol;Benzo[g]pteridine-2,4(1H,3H)-dione, 7,8-dimethyl-;Lumichrome (I);Riboflavin lumichrome;7,8-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione;7,8-DIMETHYLALLOXAZINE;7,8-Dimethylbenzo[g]pteridine-2,4(3H,10H)-dione |
| CAS: | 1086-80-2 |
| MF: | C12H10N4O2 |
| MW: | 242.23 |
| EINECS: | 214-120-8 |
| Product Categories: | |
| Mol File: | 1086-80-2.mol |
|
LUMICHROME Chemical Properties
| Melting point | 300 °C |
| Boiling point | 385.06°C (rough estimate) |
| density | 1.2532 (rough estimate) |
| refractive index | 1.6081 (estimate) |
| storage temp. | Refrigerator |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated) |
| form | Solid |
| pKa | 10.02±0.70(Predicted) |
| color | Pale Yellow to Yellow |
| λmax | 350 nm
392 nm (2nd) |
| Merck | 13,5620 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Major Application | diagnostic assay manufacturing
hematology
histology |
| InChI | 1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3NC(=O)NC(=O)c3nc2cc1C |
| CAS DataBase Reference | 1086-80-2(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2933.99.8210 |
| Storage Class | 11 - Combustible Solids |
LUMICHROME Usage And Synthesis
| Uses | Lumichrome is a derivative of Riboflavin, a vitamin with a key role in maintaining cellular function and health in human and animals. Dyes and metabolites. |
| Chemical Properties | solid |
| Uses | Lumichrome is a derivative of Riboflavin (R415000), a vitamin with a key role in maintaining cellular function and health in human and animals. Dyes and metabolites. |
| Definition | ChEBI: A compound showing blue fluorescence, formed by a photolysis of riboflavin in acid or neutral solution. |
| in vivo | Lumichrome (7.5 mg/kg, ip, three times a week for 6 weeks) reduces bone loss and prevents osteoporosis in the ovariectomized (OVX) mouse model[3]. | Animal Model: | OVX mouse model[3] | | Dosage: | 7.5 mg/kg | | Administration: | ip, three times a week for 6 weeks | | Result: | Increased bone mineral density (BMD) and bone volume fraction (BV/TV) in OVX mice, and reduced the osteoclast surface/bone surface (Oc.S/BS) ratio. |
|
| Purification Methods | Recrystallise lumichrome twice from glacial AcOH and dry it at 100o in a vacuum. [Cresswell & Wood J Chem Soc 4768 1960, Beilstein 26 III/IV 2538.] |
LUMICHROME Preparation Products And Raw materials
| Raw materials | Carbamic acid, [3-(aminocarbonyl)-6,7-dimethyl-2-quinoxalinyl]-, ethyl ester (9CI)-->LUMIFLAVINE-->Riboflavin-->4,6-DIMETHYL-1,2-PHENYLENEDIAMINE |
