MERSALYL ACID CAS 486-67-9
Introduction:Basic information about MERSALYL ACID CAS 486-67-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
MERSALYL ACID Basic information
| Product Name: | MERSALYL ACID |
| Synonyms: | 2-(3-HYDROXYMERCURIO-2-METHOXYPROPYLCARBAMOYL)PHENOXYACETIC ACID;MERSALYL ACID CRYSTALLINE;MERSALYL ACID;TIMTEC-BB SBB006336;SALYRGANIC ACID;O-[(3-HYDROXYMERCURI-2-METHOXY-PROPYL)CARBAMOYL]PHENOXYACETIC ACID;[3-[[2-(Carboxymethoxy)benzoyl]amino]-2-methoxypropyl]hydroxymercury(II);2-[N-(3-Hydroxymercuri-2-methoxypropyl)carbamoyl]phenoxyacetic acid |
| CAS: | 486-67-9 |
| MF: | C13H17HgNO6 |
| MW: | 483.87 |
| EINECS: | 207-637-5 |
| Product Categories: | |
| Mol File: | 486-67-9.mol |
MERSALYL ACID Chemical Properties
| Melting point | 192-193 °C (dec.)(lit.) |
| solubility | NH4OH: clear to hazy |
| Merck | 13,5928 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C13H16NO5.Hg.H2O/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);;1H2/q;+1;/p-1 |
| InChIKey | HQRSUIDICNOLPX-UHFFFAOYSA-M |
| SMILES | COC(CNC(=O)c1ccccc1OCC(O)=O)C[Hg]O |
| CAS DataBase Reference | 486-67-9 |
Safety Information
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-33-50/53 |
| Safety Statements | 13-28-36-45-60-61 |
| RIDADR | UN 2025 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Uses | Sulfhydryl specific biochemical probe. |
| Definition | ChEBI: Mersalyl acid is a monocarboxylic acid. |
