Introduction：Basic information about Methyclothiazide CAS 135-07-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methyclothiazide Basic information
| Product Name: | Methyclothiazide |
| Synonyms: | METHYCLOTHIAZIDE;2-methyl-,1,1-dioxide;4-benzothiadiazine-7-sulfonamide,6-chloro-3-(chloromethyl)-3,4-dihydro-2h-2;6-chloro-3-(chloromethyl)-3,4-dihydro-2-methyl-2h-1,2,4-benzothiadiazine-7-sul;6-chloro-3-chloromethyl-2-methyl-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine;methychlothiazide;methyclothiazid;methycyclothiazide |
| CAS: | 135-07-9 |
| MF: | C9H11Cl2N3O4S2 |
| MW: | 360.24 |
| EINECS: | 205-172-2 |
| Product Categories: | Inhibitors;TYLAN |
| Mol File: | 135-07-9.mol |
|
Methyclothiazide Chemical Properties
| Melting point | 225° |
| Boiling point | 597.9±60.0 °C(Predicted) |
| density | 1.6122 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.4(at 25℃) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 50mg/L(room temperature) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) |
| InChIKey | CESYKOGBSMNBPD-UHFFFAOYSA-N |
| SMILES | [S]1(=O)(=O)N(C(Nc2c1cc(c(c2)Cl)[S](=O)(=O)N)CCl)C |
| EPA Substance Registry System | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3-(chloromethyl)-3,4-dihydro-2-methyl-, 1,1-dioxide (135-07-9) |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2935904000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 135-07-9(Hazardous Substances Data) |
Methyclothiazide Usage And Synthesis
| Uses | antibacterial |
| Uses | Methyclothiazid, is derivative of Hydrochlorothiazide (H714560), which is a diuretic used in the hospital or for personal use to promote excess fluid associated with congestive heart failure. It is also used as an antihypertensive. |
| Definition | ChEBI: Methyclothiazide is a benzothiadiazine. |
| Brand name | Aquatensen (Medpointe);Enduron (Abbott). |
Methyclothiazide Preparation Products And Raw materials
