Methylcyclohexane-d14 CAS 10120-28-2
Introduction：Basic information about Methylcyclohexane-d14 CAS 10120-28-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Methylcyclohexane-d14 Basic information
| Product Name: | Methylcyclohexane-d14 |
| Synonyms: | METHYLCYCLOHEXANE-D14;Methylcyclohexane-D14 >99.5 Atom % D;[2H14]methylcyclohexane;METHYLCYCLOHEXANE-D14, 99 ATOM % D;Methylcyclohexane-d14,99.5%(Isotopic);Methylcyclohexane-d14,99.5%,isotopic;MethylcyclohexaneD14>99.6%;METHYLCYCLOHEXANE-D14, PACKAGED IN AMPULES, 99 ATOM% D, FOR NMR |
| CAS: | 10120-28-2 |
| MF: | C7D14 |
| MW: | 112.27 |
| EINECS: | 233-325-3 |
| Product Categories: | Alphabetical Listings;MStable Isotopes;NMR - Solvents;NMR Solvents and Reagents;NMRStable Isotopes;Stable Isotopes |
| Mol File: | 10120-28-2.mol |
Methylcyclohexane-d14 Chemical Properties
| Melting point | -126 °C |
| Melting point | -126°C |
| Boiling point | 101°C |
| Boiling point | 101 °C |
| density | d= 0,88 |
| density | 0.88 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 25 °F |
| storage temp. | Flammables area |
| solubility | 0.1g/l |
| form | Liquid |
| color | Clear colorless |
| Appearance | Clear colorless liquid |
| explosive limit | 1.1-6.7%(V) |
| InChI | InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D |
| InChIKey | UAEPNZWRGJTJPN-OBYKGMMLSA-N |
| SMILES | C([2H])([2H])([2H])C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| CAS DataBase Reference | 10120-28-2(CAS DataBase Reference) |
| EPA Substance Registry System | Methylcyclohexane-d14 (10120-28-2) |
Safety Information
| Hazard Codes | F,Xi,N,Xn |
| Risk Statements | 11-67-65-51/53-38 |
| Safety Statements | 9-16-33-62-61 |
| RIDADR | UN 2296 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Chemical Properties | clear colorless liquid |
| Uses | NMR Solvents |
Methylcyclohexane-d14 Preparation Products And Raw materials
