Introduction：Basic information about N-(Allyloxycarbonyloxy)succinimide CAS 135544-68-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-(Allyloxycarbonyloxy)succinimide Basic information
| Product Name: | N-(Allyloxycarbonyloxy)succinimide |
| Synonyms: | N-(Allyloxycarbonyloxy)succinimide;Allyl N-succinimidyl carbonate;ALOC-OSU Allyloxycarbonyl succiniMidyl ester;Allyl (2,5-dioxopyrrolidin-1-yl) carbonate;Allyl n-sccinimidyl carbonate;N-(Allyloxycarbonyloxy)succinimide;Aloc N-hydroxyuccinimide ester;Aloc-OSu≥ 98% (HPLC) |
| CAS: | 135544-68-2 |
| MF: | C8H9NO5 |
| MW: | 199.16 |
| EINECS: | 677-127-9 |
| Product Categories: | |
| Mol File: | 135544-68-2.mol |
|
N-(Allyloxycarbonyloxy)succinimide Chemical Properties
| Melting point | 21 °C |
| Boiling point | 269.5±33.0 °C(Predicted) |
| density | 1.287 g/mL at 25 °C |
| refractive index | n20/D1.482 |
| Fp | 117℃ |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | InChI=1S/C8H9NO5/c1-2-5-13-8(12)14-9-6(10)3-4-7(9)11/h2H,1,3-5H2 |
| InChIKey | OIXALTPBNZNFLJ-UHFFFAOYSA-N |
| SMILES | C(OCC=C)(=O)ON1C(=O)CCC1=O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
N-(Allyloxycarbonyloxy)succinimide Usage And Synthesis
| Chemical Properties | Low melting solid to liquid |
| Uses | N-(Allyloxycarbonyloxy)succinimide (alloc-Su) can be used as:
- A building block for the preparation of glycopeptide scaffolds.
- A reagent in the synthesis of various functional cyclic carbonate monomers from 2-amino-1,3-propane diols.
|
N-(Allyloxycarbonyloxy)succinimide Preparation Products And Raw materials
| Preparation Products | ALOC-ALA-OH DCHA |
