Introduction：Basic information about N-Cbz-L-glutamic acid CAS 1155-62-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-Cbz-L-glutamic acid Basic information
| Product Name: | N-Cbz-L-glutamic acid |
| Synonyms: | n-[(phenylmethoxy)carbonyl]-l-glutamicaci;(2S)-2-(Phenylmethoxycarbonylamino)pentanedioic acid;N-(Benzyloxycarbonyl)glutamic acid;N-BENZYLOXYCARBONYL-L-GLUTAMIC ACID 99%;(2S)-2-(Benzyloxycarbonylamino)glutaric acid;(S)-2-(Benzyloxycarbonylamino)-3-(carboxymethyl)propionic acid;N-Benzyloxycarbonyl-L-glutamic acid,99%;N-Cbz-L-glutamic aci |
| CAS: | 1155-62-0 |
| MF: | C13H15NO6 |
| MW: | 281.26 |
| EINECS: | 214-584-1 |
| Product Categories: | PROTECTED AMINO ACID & PEPTIDES;Amino Acid Derivatives;Glutamic acid [Glu, E];Z-Amino acid series;Amino Acids & Derivatives;Chiral Compounds;Aromatics;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals;Protected Amino Acids;Z-Amino Acids and Derivatives;Amino Acids;Amino Acids (N-Protected);Biochemistry;Cbz-Amino Acids;ADVANCED INT. |
| Mol File: | 1155-62-0.mol |
|
N-Cbz-L-glutamic acid Chemical Properties
| Melting point | 115-117 °C(lit.) |
| alpha | -7.4 º (c=10, CH3COOH 22 ºC) |
| Boiling point | 423.93°C (rough estimate) |
| density | 1.2801 (rough estimate) |
| refractive index | -7.5 ° (C=8, AcOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF, Methanol |
| pka | 3.81±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| Optical Rotation | [α]22/D 7.4°, c = 10 in acetic acid |
| BRN | 2061272 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H15NO6/c15-11(16)7-6-10(12(17)18)14-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,19)(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | PVFCXMDXBIEMQG-JTQLQIEISA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 1155-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | L-Glutamic acid, N-[(phenylmethoxy)carbonyl]- (1155-62-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
N-Cbz-L-glutamic acid Usage And Synthesis
| Chemical Properties | Off-White Solid |
| Uses | N-Cbz-L-glutamic acid is used for the synthesis. |
| Uses | Used for the synthesis of carboxyalkyl peptides as inhibitors of angiotensin-converting enzyme of human blood serum. |
| reaction suitability | reaction type: solution phase peptide synthesis |
N-Cbz-L-glutamic acid Preparation Products And Raw materials
| Raw materials | N-benzyloxycarbonyl-L-glutamic anhydride-->Z-PYR-OH |
| Preparation Products | isoglutamine-->N-Cbz-L-Glutamic acid 5-tert-butyl ester-->L-GLUTAMIC ACID DI-TERT-BUTYLESTER DIBEN ZENESULFIMIDE SALT-->H-Glu(OMe)-OtBu-->Carbamic acid, (2,6-dioxo-3-piperidinyl)-, phenylmethyl ester (9CI) |
