Introduction：Basic information about N-Cbz-L-Isoleucine CAS 3160-59-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
N-Cbz-L-Isoleucine Basic information
| Product Name: | N-Cbz-L-Isoleucine |
| Synonyms: | Z-L-ISOLEUCINE extrapure;N-Carbobenzyloxy-L-isoleucine, Z-Ile-OH;N-Carbobenzyloxy-L-isoleucine,97%;N-Carbobenzyloxy-L-isoleucine,99+%;3-Methyl-2-(phenylmethoxycarbonylamino)pentanoic acid;L-Isoleucine, N-[(phenylmethoxy)carbonyl]-;N-Cbz-L-isoleucineZ-Ile-OH;(2S,3S)-2-(((benzyloxy)carbonyl)aMino)-3-Methylpentanoic acid |
| CAS: | 3160-59-6 |
| MF: | C14H19NO4 |
| MW: | 265.3 |
| EINECS: | 221-611-0 |
| Product Categories: | Isoleucine [Ile, I];Z-Amino Acids and Derivatives;Amino Acids;Amino Acids (N-Protected);Biochemistry;Cbz-Amino Acids;Cbz-Amino acid series;Amino Acid Derivatives |
| Mol File: | 3160-59-6.mol |
|
N-Cbz-L-Isoleucine Chemical Properties
| Melting point | 52-54 °C(lit.) |
| alpha | 7 º (c=6, EtOH) |
| Boiling point | 408.52°C (rough estimate) |
| density | 1.1356 (rough estimate) |
| refractive index | 6.5 ° (C=6, EtOH) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Sparingly) |
| pka | 4.02±0.22(Predicted) |
| form | Off-White Semi-Solid |
| color | White or Colorless to Almost white or Almost colorless |
| Optical Rotation | [α]20/D +6.0°, c = 6 in ethanol |
| BRN | 4189486 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H19NO4/c1-3-10(2)12(13(16)17)15-14(18)19-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,15,18)(H,16,17)/t10-,12-/m0/s1 |
| InChIKey | JSHXJPFZKBRLFU-JQWIXIFHSA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C)CC)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 3160-59-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
N-Cbz-L-Isoleucine Usage And Synthesis
| Chemical Properties | white to yellowish weak solid |
| Uses | N-Cbz-L-isoleucine is an N-Cbz-protected form of L-Isoleucine (I820175). L-Isoleucine is classified as an essential amino acid, and is also a tumour promoter of bladder cancer in rats. |
| reaction suitability | reaction type: solution phase peptide synthesis |
N-Cbz-L-Isoleucine Preparation Products And Raw materials
| Preparation Products | dolastatin 10-->Benzyl (2S,3S)-1-(1H-benzo[d][1,2,3]triazol-1-yl)-3-methyl-1-oxopentan-2-ylcarbamate-->H-Ile-NCA-->Z-ILE-ILE-OH |
