Introduction：Basic information about Niranthin CAS 50656-77-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Niranthin Basic information
| Product Name: | Niranthin |
| Synonyms: | Niranthin;4-Methylenedioxylignan;9'-PentaMethoxy-3;3',4',5,9,9'-PentaMethoxy-3,4-Methylenedioxylignan;rac-Niranthin;Pearlgrass;1,3-Benzodioxole,6-[(2R,3R)-4-(3,4-dimethoxyphenyl)-2,3-bis(methoxymethyl)butyl]-4-methoxy-,rel-;6-[(2R,3R)-3-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-2-(methoxymethyl)butyl]-4-methoxy-1,3-benzodioxole |
| CAS: | 50656-77-4 |
| MF: | C24H32O7 |
| MW: | 432.51 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 50656-77-4.mol |
|
Niranthin Chemical Properties
| Boiling point | 559.5±50.0 °C(Predicted) |
| density | 1.142±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF: 15 mg/ml,DMSO: 10 mg/ml,Ethanol: 5 mg/ml |
| InChI | 1S/C24H32O7/c1-25-13-18(8-16-6-7-20(27-3)21(10-16)28-4)19(14-26-2)9-17-11-22(29-5)24-23(12-17)30-15-31-24/h6-7,10-12,18-19H,8-9,13-15H2,1-5H3/t18-,19-/m0/s1 |
| InChIKey | RCFGIEPQSDGMJJ-OALUTQOASA-N |
| SMILES | COC1=C(OCO2)C2=CC(C[C@H](COC)[C@@H](COC)CC3=CC=C(OC)C(OC)=C3)=C1 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
Niranthin Usage And Synthesis
| Uses | rac-Niranthin is a lignan compound isolated from the plant Phyllanthus amarus and shows anti-leishmanial activity. It acts through induction of topoisomerase I-mediated DNA-protein adduct formation in Leishmania cells triggering apoptosis of cellular nucleases. It also maintains the ability to reduce uric acid concentrations through xanthine oxidase inhibition. |
| IC 50 | Leishmania; Topoisomerase |
Niranthin Preparation Products And Raw materials
