Introduction：Basic information about Ofurace CAS 58810-48-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Ofurace Basic information
| Product Name: | Ofurace |
| Synonyms: | 2-chloro-2’,6’-dimethyl-n-(2-oxotetrahydro-3-furyl)-acetanilid;2-chloro-2’,6’-dimethyl-n-(2-oxotetrahydro-3-furyl)acetanilide;(+/-)-2-chloro-n-(2,6-dimethylphenyl)-n-(tetrahydro-2-oxo-3-furanyl)-acetamide;2-CHLORO-N-(2,6-DIMETHYLPHENYL)-N-(2-OXOOXOLAN-3-YL)-ETHANAMIDE;PATAFOL;OFURACE;VAMIN;Ofurace solution |
| CAS: | 58810-48-3 |
| MF: | C14H16ClNO3 |
| MW: | 281.73 |
| EINECS: | 261-451-9 |
| Product Categories: | Alpha sort;Alphabetic;Amide structurePesticides&Metabolites;Fungicides;N-PAnalytical Standards;O;Pesticides |
| Mol File: | 58810-48-3.mol |
|
Ofurace Chemical Properties
| Melting point | 145.5 °C |
| Boiling point | 482.7±45.0 °C(Predicted) |
| density | 1.1985 (rough estimate) |
| refractive index | 1.6470 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 1.35±0.20(Predicted) |
| color | White |
| BRN | 1653655 |
| Major Application | agriculture
environmental |
| InChI | 1S/C14H16ClNO3/c1-9-4-3-5-10(2)13(9)16(12(17)8-15)11-6-7-19-14(11)18/h3-5,11H,6-8H2,1-2H3 |
| InChIKey | OWDLFBLNMPCXSD-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N(C2CCOC2=O)C(=O)CCl |
| NIST Chemistry Reference | Acetamide, 2-chloro-n-(2,6-dimethylphenyl)-n-(tetrahydro-2-oxo-3-furanyl)-(58810-48-3) |
| EPA Substance Registry System | Acetamide, 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)- (58810-48-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 36 |
| WGK Germany | 2 |
| RTECS | AE1300200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
Ofurace Usage And Synthesis
| Uses | Ofurace is a systematic fungicide used to control diseases caused by phycomycetes. Ofurace is commonly used in agriculture to control potato late blight. |
| Definition | ChEBI: 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydrofuran-3-yl)acetamide is an aromatic amide that is 2,6-dimethylaniline in which the two amino hydrogens are replaced by chloroacetyl and 2-oxotetrahydrofuran-3-yl groups It is an aromatic amide, an organochlorine compound, a butan-4-olide and a tertiary carboxamide. |
Ofurace Preparation Products And Raw materials
