O-geranylconiferyl alcohol CAS 129350-09-0
Introduction：Basic information about O-geranylconiferyl alcohol CAS 129350-09-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
O-geranylconiferyl alcohol Basic information
| Product Name: | O-geranylconiferyl alcohol |
| Synonyms: | O-geranylconiferyl alcohol;(2E)-3-[4-[[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-2-propen-1-ol;3-(4-((3,7-DiMethylocta-2,6-dien-1-yl)oxy)-3-Methoxyphenyl)prop-2-en-1-ol;Conifegrol;2-Propen-1-ol, 3-[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-, (2E)-;Conifegrol >=95% (LC/MS-ELSD);3-[4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxyphenyl]prop-2-en-1-ol;(E)-3-(4-(((E)-3,7-dimethylocta-2,6-dien-1-yl)oxy)-3-methoxyphenyl)prop-2-en-1-ol |
| CAS: | 129350-09-0 |
| MF: | C20H28O3 |
| MW: | 316.43 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 129350-09-0.mol |
O-geranylconiferyl alcohol Chemical Properties
| storage temp. | -20°C |
| form | solid |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C20H28O3/c1-16(2)7-5-8-17(3)12-14-23-19-11-10-18(9-6-13-21)15-20(19)22-4/h6-7,9-12,15,21H,5,8,13-14H2,1-4H3/b9-6+,17-12+ |
| InChIKey | UJQXYSRVSXKEES-YIERNNEGSA-N |
| SMILES | COc1cc(\C=C\CO)ccc1OC\C=C(/C)CC\C=C(/C)C |
| LogP | 4.642 (est) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Uses | metabolomics vitamins, nutraceuticals, and natural products |
O-geranylconiferyl alcohol Preparation Products And Raw materials
