Introduction:Basic information about Perfluorohexanoic acid CAS 307-24-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Perfluorohexanoic acid Basic information
| Product Name: | Perfluorohexanoic acid |
| Synonyms: | Undecafluorohexanoic acid >=97.0% (T);Hexanoic acid,2,2,3,3,4,4,5,5,6,6,6-undecafluoro-;IPC-PFFA-6 (ca. 5mmol);IPC-PFFA-6;PERFLUOROHEXANOIC ACID;PERFLUOROCAPROIC ACID;UNDECAFLUOROHEXANOIC ACID;perfluorohexanoic |
| CAS: | 307-24-4 |
| MF: | C6HF11O2 |
| MW: | 314.05 |
| EINECS: | 206-196-6 |
| Product Categories: | Fluorous Chemistry;Fluorous Compounds;Analytical Chemistry;Ion-Pair Reagents for HPLC;LC/MS Ion-Pair Reagents for Basic Samples;Synthetic Organic Chemistry |
| Mol File: | 307-24-4.mol |
|
Perfluorohexanoic acid Chemical Properties
| Melting point | 14 °C |
| Boiling point | 157 °C |
| density | 1.759 g/mL at 20 °C(lit.) |
| refractive index | n20/D 1.301 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | water: insoluble |
| pka | 0.42±0.10(Predicted) |
| form | powder to lump to clear liquid |
| Specific Gravity | 1.762 |
| color | White or Colorless to Almost white or Almost colorless |
| Water Solubility | water: insoluble |
| BRN | 1805852 |
| Stability: | Stable, but may be light sensitive. Incompatible with oxidizing agents. |
| InChI | 1S/C6HF11O2/c7-2(8,1(18)19)3(9,10)4(11,12)5(13,14)6(15,16)17/h(H,18,19) |
| InChIKey | PXUULQAPEKKVAH-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 307-24-4(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorohexanoic acid (307-24-4) |
Safety Information
| Hazard Codes | C,T |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 3-8 |
| Hazard Note | Corrosive/Toxic |
| TSCA | TSCA listed |
| HazardClass | CORROSIVE |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 307-24-4(Hazardous Substances Data) |
Perfluorohexanoic acid Usage And Synthesis
| Chemical Properties | Perfluorohexanoic acid (PFHxA) exists as a colourless liquid, it is insoluble in water. Perfluorohexanoic acid has the ability to react with strong oxidizing agents. Upon decomposition, PFHxA can form carbon oxides and hydrogen fluoride. Additional information related to the physical and chemical properties of PFHxA are not currently available. |
| Uses | Perfluorohexanoic acid (PFHxA, perfluorocaproic acid, undecafluorohexanoic acid, undecafluoro-1-hexanoic Acid) is a six-carbon compound in the perfluoroalkyl family of chemicals. Perfluorohexanoic acid is used in stain- and grease-proof coatings on furniture, carpet, and food packaging. Perfluorohexanoic acid is the six-carbon version of the highly persistent and outlawed PFOA. Much like other perfluoroalkyls, PFHxA can persist in the environment. |
| Uses | Undecafluorohexanoic acid, a volatile ion-pair reagent, has been used as mobile phase for LC-MS analysis of highly polar sulfonium pseudo-sugar constituents neosalacinol and neokotalanol, potential α-glucosidase inhibitors isolated from ayurvedic traditional medicine Salacia species. |
| Definition | ChEBI: A monocarboxylic acid that is perfluorinated hexanoic acid. |
Perfluorohexanoic acid Preparation Products And Raw materials
| Preparation Products | Heptafluorobutyric acid |