Introduction：Basic information about Phenyltris(dimethylsiloxy)silane CAS 18027-45-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Phenyltris(dimethylsiloxy)silane Basic information
| Product Name: | Phenyltris(dimethylsiloxy)silane |
| Synonyms: | Phenyl-tri(diMethylsiloxy)silane;3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl-trisiloxan;3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl-Trisiloxane;PHENYLTRIS(DIMETHYLSILOXY)SILANE;TRIS(DIMETHYLSILYLOXY)PHENYLSILANE;Tris(dimethylsiloxy)phenylsilane;TRIS(DIMETHYLSILYLOXY)PHENYLSILANE 96%;Trisiloxane,3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl- |
| CAS: | 18027-45-7 |
| MF: | C12H26O3Si4 |
| MW: | 330.67 |
| EINECS: | 241-940-3 |
| Product Categories: | |
| Mol File: | 18027-45-7.mol |
|
Phenyltris(dimethylsiloxy)silane Chemical Properties
| Melting point | <0°C |
| Boiling point | 91 °C2 mm Hg(lit.) |
| density | 0.942 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.442(lit.) |
| Fp | 188 °F |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| Specific Gravity | 0.942 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 3380327 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | InChI=1S/C12H26O3Si4/c1-16(2)13-19(14-17(3)4,15-18(5)6)12-10-8-7-9-11-12/h7-11,16-18H,1-6H3 |
| InChIKey | CQZDNELEZXTFEH-UHFFFAOYSA-N |
| SMILES | [SiH](C)(C)O[Si](O[SiH](C)C)(C1=CC=CC=C1)O[SiH](C)C |
| CAS DataBase Reference | 18027-45-7(CAS DataBase Reference) |
| EPA Substance Registry System | Trisiloxane, 3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl- (18027-45-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
Phenyltris(dimethylsiloxy)silane Usage And Synthesis
| Description | Phenyltris(dimethylsiloxy)silane, miscibility with dimethyl siloxane, liquid silicone rubber, phenyl silicone rubber and phenyl resin. It's used as crosslinker of liquid silicone rubber, phenyl silicone rubber and phenyl resin. |
Phenyltris(dimethylsiloxy)silane Preparation Products And Raw materials
| Raw materials | 1,1,3,3-Tetramethyldisiloxane-->Phenyltrichlorosilane-->Chlorodimethylsilane-->Trimethoxyphenylsilane |
