Introduction:Basic information about CAS 613239-76-2|2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)pyridine |
|---|
| CAS Number | 613239-76-2 | Molecular Weight | 271.66500 |
|---|
| Density | 1.299g/cm3 | Boiling Point | 327.876ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9ClF3N | Melting Point | 77-78ºC |
|---|
| MSDS | / | Flash Point | 152.094ºC |
|---|
Names
| Name | 2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)pyridine |
|---|
Chemical & Physical Properties
| Density | 1.299g/cm3 |
|---|
| Boiling Point | 327.876ºC at 760 mmHg |
|---|
| Melting Point | 77-78ºC |
|---|
| Molecular Formula | C13H9ClF3N |
|---|
| Molecular Weight | 271.66500 |
|---|
| Flash Point | 152.094ºC |
|---|
| Exact Mass | 271.03800 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.50620 |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | JTXHHQDYEHXWPC-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(-c2ccc(CCl)cc2)nc1 |
|---|