Introduction：Basic information about CAS 162706-37-8|Elinafide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Elinafide |
|---|
| CAS Number | 162706-37-8 | Molecular Weight | 520.57800 |
|---|
| Density | 1.344g/cm3 | Boiling Point | 750.7ºC at 760mmHg |
|---|
| Molecular Formula | C31H28N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 407.8ºC |
|---|
Names
| Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.344g/cm3 |
|---|
| Boiling Point | 750.7ºC at 760mmHg |
|---|
| Molecular Formula | C31H28N4O4 |
|---|
| Molecular Weight | 520.57800 |
|---|
| Flash Point | 407.8ºC |
|---|
| Exact Mass | 520.21100 |
|---|
| PSA | 102.20000 |
|---|
| LogP | 3.27010 |
|---|
| Vapour Pressure | 2.04E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | QUNOQBDEVTWCTA-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCNCCCNCCN1C(=O)c2cccc3cccc(c23)C1=O |
|---|
Synonyms
| Elinafide |
| Elinafide [INN] |
| N,N'-(Trimethylenebis(iminoethylene))dinaphthalimide |
