Introduction:Basic information about CAS 166412-78-8|Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate |
|---|
| CAS Number | 166412-78-8 | Molecular Weight | 424.657 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 489.6±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H46O4-- | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.6±20.2 °C |
|---|
Names
| Name | Di-isononyl-cyclohexane-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 489.6±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H46O4-- |
|---|
| Molecular Weight | 424.657 |
|---|
| Flash Point | 229.6±20.2 °C |
|---|
| Exact Mass | 424.355255 |
|---|
| PSA | 80.26000 |
|---|
| LogP | 9.69 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.466 |
|---|
| InChIKey | HORIEOQXBKUKGQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CCCCCCOC(=O)C1CCCCC1C(=O)OCCCCCCC(C)C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2917209090 |
|---|
Customs
| HS Code | 2917209090 |
|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| 1,2-Cyclohexanedicarboxylic acid, bis(7-methyloctyl) ester |
| Dinch |
| 1,2-CYCLOHEXYLDICARBOXYLICACID,DIISONONYLESTER |
| Diisononyl 1,2-cyclohexanedicarboxylate |
| Bis(7-methyloctyl) 1,2-cyclohexanedicarboxylate |
| 1,2-Cyclohexanedicarboxylic acid diisononyl ester |
| Di-isononyl-cyclohex |
| Hexamoll dinch |
| Diisononyl cyclohexane-1,2-dicarboxylate |
| Diisononyl hexahydrophthalate |