Introduction：Basic information about CAS 446-20-8|5-Fluoro-4-methoxy-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Fluoro-4-methoxy-2-nitroaniline |
|---|
| CAS Number | 446-20-8 | Molecular Weight | 186.141 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 355.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7FN2O3 | Melting Point | 142.5-143.5 °C |
|---|
| MSDS | / | Flash Point | 168.7±26.5 °C |
|---|
Names
| Name | 5-fluoro-4-methoxy-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 355.4±37.0 °C at 760 mmHg |
|---|
| Melting Point | 142.5-143.5 °C |
|---|
| Molecular Formula | C7H7FN2O3 |
|---|
| Molecular Weight | 186.141 |
|---|
| Flash Point | 168.7±26.5 °C |
|---|
| Exact Mass | 186.044067 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 2.14 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | RVAJIOQIKOUNON-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c(N)cc1F |
|---|
Synonyms
| 5-Fluoro-4-methoxy-2-nitroaniline |
| 5-fluoro-4-methoxy-2-nitro-aniline |
| 5-Fluoro-4-methoxy-2-nitrobenzenamine |
| 5-Fluor-2-nitro-p-anisidin |
| 5-Fluor-4-methoxy-2-nitro-anilin |
| 4-Amino-2-fluoro-5-nitroanisole |
| Benzenamine, 5-fluoro-4-methoxy-2-nitro- |
