Introduction：Basic information about CAS 4462-95-7|2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid |
|---|
| CAS Number | 4462-95-7 | Molecular Weight | 296.31700 |
|---|
| Density | 1.323 g/cm3 | Boiling Point | 470.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.4ºC |
|---|
Names
| Name | 2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.323 g/cm3 |
|---|
| Boiling Point | 470.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 |
|---|
| Molecular Weight | 296.31700 |
|---|
| Flash Point | 252.4ºC |
|---|
| Exact Mass | 296.10500 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.96920 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | QWFRRFLKWRIKSZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,4-Diphenyl-cyclobutan-1,3-dicarbonsaeure |
| truxillic acid |
| 2,4-diphenyl-cyclobutane-1,3-dicarboxylic acid |
| 2,4-Diphenyl-cyclobutan-dicarbonsaeure-(1,3) |
| Einecs 224-724-3 |
