Introduction：Basic information about CAS 3663-35-2|Benzenamine,4-ethyl-2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,4-ethyl-2-nitro- |
|---|
| CAS Number | 3663-35-2 | Molecular Weight | 166.17700 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 314ºC at 760mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.7ºC |
|---|
Names
| Name | 4-ethyl-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 314ºC at 760mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.17700 |
|---|
| Flash Point | 143.7ºC |
|---|
| Exact Mass | 166.07400 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.84380 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | RUQAPQLDPWSAQM-UHFFFAOYSA-N |
|---|
| SMILES | CCC1=CC(=C(C=C1)N)[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Aethyl-2-nitro-anilin |
| o-nitro-p-ethylaniline |
| 2-nitro-4-ethylaniline |
| 4-ethyl-2-nitrobenzenamine |
| 4-ethyl-2-nitro-aniline |
| 3-Nitro-4-amino-1-aethyl-benzol |
