Introduction:Basic information about CAS 362507-64-0|N-[(1S)-1-[[[(4R,7S)-Hexahydro-7-methyl-3-oxo-1-(2-pyridinylsulfonyl)-1H-azep, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[(1S)-1-[[[(4R,7S)-Hexahydro-7-methyl-3-oxo-1-(2-pyridinylsulfonyl)-1H-azepin-4-yl]amino]carbonyl]-3-methylbutyl]-2-benzofurancarboxamide |
|---|
| CAS Number | 362507-64-0 | Molecular Weight | 540.63100 |
|---|
| Density | 1.34g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C27H32N4O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-[(2S)-4-methyl-1-[[(4R,7S)-7-methyl-3-oxo-1-pyridin-2-ylsulfonylazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Molecular Formula | C27H32N4O6S |
|---|
| Molecular Weight | 540.63100 |
|---|
| Exact Mass | 540.20400 |
|---|
| PSA | 147.06000 |
|---|
| LogP | 4.69990 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | BWYBBMQLUKXECQ-TYPHKJRUSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)c1cc2ccccc2o1)C(=O)NC1CCC(C)N(S(=O)(=O)c2ccccn2)CC1=O |
|---|