Introduction：Basic information about CAS 6108-10-7|epsilon-HCH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | epsilon-HCH |
|---|
| CAS Number | 6108-10-7 | Molecular Weight | 290.83000 |
|---|
| Density | 1.59g/cm3 | Boiling Point | 60ºC AT 0.36 mm Hg |
|---|
| Molecular Formula | C6H6Cl6 | Melting Point | 141.5ºC |
|---|
| MSDS | / | Flash Point | 157.5ºC |
|---|
Names
| Name | ε-HCH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Boiling Point | 60ºC AT 0.36 mm Hg |
|---|
| Melting Point | 141.5ºC |
|---|
| Molecular Formula | C6H6Cl6 |
|---|
| Molecular Weight | 290.83000 |
|---|
| Flash Point | 157.5ºC |
|---|
| Exact Mass | 287.86000 |
|---|
| LogP | 3.64440 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
|---|
| SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
|---|
Safety Information
Customs
| HS Code | 2903810010 |
|---|
| Summary | 2903810010 1,2,3,4,5,6-hexachlorocyclohexane。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:5.5%。general tariff:30.0% |
|---|
Synonyms
| Lysactone |
| GDL |
| gluconodeltalactone |
| Glucopyrone |
| glucolactone |
| GLUCONOLACTONE |
| Glucarolactone |
| GlucoMalactone |
| Fujiglucon |
| Glucono |
| epsilon-HCH |
| EINECS 228-068-9 |
