Introduction:Basic information about CAS 61586-78-5|(1R,2S)-2-Hydroxy-Cyclohexanecarboxylic Acid Ethyl Ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,2S)-2-Hydroxy-Cyclohexanecarboxylic Acid Ethyl Ester |
|---|
| CAS Number | 61586-78-5 | Molecular Weight | 172.22200 |
|---|
| Density | 1.093 g/cm3 | Boiling Point | 251.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 100.2ºC |
|---|
Names
| Name | ethyl (1r,2s)-cis-2-hydroxycyclohexanecarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.093 g/cm3 |
|---|
| Boiling Point | 251.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H16O3 |
|---|
| Molecular Weight | 172.22200 |
|---|
| Flash Point | 100.2ºC |
|---|
| Exact Mass | 172.11000 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 1.10060 |
|---|
| Index of Refraction | n20/D 1.463 |
|---|
| InChIKey | WOGRTPJVNNCUKN-SFYZADRCSA-N |
|---|
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1O |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Ethyl-trans-2-cyanocyclopropancarboxylat |
| trans-1-Cyano-2-ethoxycarbonyl-cyclopropan |
| trans-1-Cyan-2-ethoxycarbonyl-cyclopropan |
| (1R,2S)-2-Hydroxy-Cyclohexanecarboxylic Acid Ethyl Ester |
| ethyl (1R,2S)-2-hydroxycyclohexanecarboxylate |