Introduction：Basic information about CAS 132628-16-1|N-(Phenylacetyl)guanosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(Phenylacetyl)guanosine |
|---|
| CAS Number | 132628-16-1 | Molecular Weight | 401.373 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C18H19N5O6 | Melting Point | 189ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-3H-purin-2-yl]-2-phenylacetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Melting Point | 189ºC |
|---|
| Molecular Formula | C18H19N5O6 |
|---|
| Molecular Weight | 401.373 |
|---|
| Exact Mass | 401.133545 |
|---|
| PSA | 162.59000 |
|---|
| LogP | 0.41 |
|---|
| Index of Refraction | 1.784 |
|---|
| InChIKey | IRSCBAKCFOLZNC-IWCJZZDYSA-N |
|---|
| SMILES | O=C(Cc1ccccc1)Nc1nc2c(ncn2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
|---|
Synonyms
| N2-(phenylacetyl)-guanosine |
| N-(9-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-6-oxo-6,9-dihydro-1H-purin-2-yl)-2-phenylacetamide |
| Guanosine, N-(2-phenylacetyl)- |
| N-(Phenylacetyl)guanosine |
| 2-N-(phenylacetyl)guanosine |
