Introduction：Basic information about CAS 16588-15-1|Benzamide,2-chloro-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,2-chloro-5-nitro- |
|---|
| CAS Number | 16588-15-1 | Molecular Weight | 200.57900 |
|---|
| Density | 1.52 g/cm3 | Boiling Point | 299ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5ClN2O3 | Melting Point | 178 °C |
|---|
| MSDS | / | Flash Point | 134.6ºC |
|---|
Names
| Name | 2-chloro-5-nitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52 g/cm3 |
|---|
| Boiling Point | 299ºC at 760 mmHg |
|---|
| Melting Point | 178 °C |
|---|
| Molecular Formula | C7H5ClN2O3 |
|---|
| Molecular Weight | 200.57900 |
|---|
| Flash Point | 134.6ºC |
|---|
| Exact Mass | 199.99900 |
|---|
| PSA | 88.91000 |
|---|
| LogP | 2.57060 |
|---|
| Vapour Pressure | 0.00122mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | SDHXWAPVLOGAJR-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1cc([N+](=O)[O-])ccc1Cl |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-chloro-5-nitrobenzenecarboxamide |
| MFCD00088420 |
| 2-chloranyl-5-nitro-benzamide |
| 2-chloro-5-nitro-benzoic acid amide |
| 2-chloro-5-nitro-benzamide |
| 2-Chlor-5-nitro-benzoesaeure-amid |
| Benzamide,2-chloro-5-nitro |
