Introduction:Basic information about CAS 255865-29-3|6-METHOXY-7,8,9,10-TETRAHYDRO-6H-[1,2,5]OXADIAZOLO[3,4-C]CARBAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-METHOXY-7,8,9,10-TETRAHYDRO-6H-[1,2,5]OXADIAZOLO[3,4-C]CARBAZOLE |
|---|
| CAS Number | 255865-29-3 | Molecular Weight | 243.26100 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 415.5ºC at 760mmHg |
|---|
| Molecular Formula | C13H13N3O2 | Melting Point | 118-120ºC |
|---|
| MSDS | / | Flash Point | 205.1ºC |
|---|
Names
| Name | 6-methoxy-7,8,9,10-tetrahydro-[1,2,5]oxadiazolo[3,4-c]carbazole |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 415.5ºC at 760mmHg |
|---|
| Melting Point | 118-120ºC |
|---|
| Molecular Formula | C13H13N3O2 |
|---|
| Molecular Weight | 243.26100 |
|---|
| Flash Point | 205.1ºC |
|---|
| Exact Mass | 243.10100 |
|---|
| PSA | 53.08000 |
|---|
| LogP | 2.11470 |
|---|
| Vapour Pressure | 4.11E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.744 |
|---|
| InChIKey | XUEPYELDAHBGCR-UHFFFAOYSA-N |
|---|
| SMILES | COn1c2c(c3c4nonc4ccc31)CCCC2 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|