Introduction：Basic information about CAS 13122-91-3|Z-Phe-Phe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Phe-Phe-OH |
|---|
| CAS Number | 13122-91-3 | Molecular Weight | 446.49500 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 730.2ºC at 760mmHg |
|---|
| Molecular Formula | C26H26N2O5 | Melting Point | 159ºC |
|---|
| MSDS | / | Flash Point | 395.4ºC |
|---|
Names
| Name | (2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 730.2ºC at 760mmHg |
|---|
| Melting Point | 159ºC |
|---|
| Molecular Formula | C26H26N2O5 |
|---|
| Molecular Weight | 446.49500 |
|---|
| Flash Point | 395.4ºC |
|---|
| Exact Mass | 446.18400 |
|---|
| PSA | 104.73000 |
|---|
| LogP | 4.11800 |
|---|
| Vapour Pressure | 2.21E-22mmHg at 25°C |
|---|
| Index of Refraction | -10 ° (C=1, MeOH) |
|---|
| InChIKey | JNRHNGGTJOBXHL-GOTSBHOMSA-N |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O)OCc1ccccc1 |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| N-Cbz-L-Phe-L-Phe-OH |
| N-Cbz-L-phenylalanyl-L-phenylalanine |
| Cbz-L-Phe-L-Phe-OH |
| N-Carbobenzoxy-L-phenylalanyl-L-phenylalanine |
| Z-Phe-Phe-OH |
| EINECS 236-051-2 |
