Introduction：Basic information about CAS 1636-14-2|bis(diethylamino)phenylphosphine 97, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(diethylamino)phenylphosphine 97 |
|---|
| CAS Number | 1636-14-2 | Molecular Weight | 252.33500 |
|---|
| Density | 0.971 g/mL at 25 °C(lit.) | Boiling Point | 334.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H25N2P | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 156ºC |
|---|
Names
| Name | N-[diethylamino(phenyl)phosphanyl]-N-ethylethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.971 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 334.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H25N2P |
|---|
| Molecular Weight | 252.33500 |
|---|
| Flash Point | 156ºC |
|---|
| Exact Mass | 252.17600 |
|---|
| PSA | 20.07000 |
|---|
| LogP | 3.30740 |
|---|
| Vapour Pressure | 0.000129mmHg at 25°C |
|---|
| InChIKey | HTIVDCMRYKVNJC-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)P(c1ccccc1)N(CC)CC |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| phenylphosphonous acid |
| Ph-P(NEt2)2 |
| bis(N,N-diethylamino)phenylphosphane |
| Phenylphosphonous tetraethyldiamide |
| N,N,N',N'-tetraethyl phenylphosphonous diamide |
| tetraethyldiamide |
| Bis(diethylamino)phenylphosphine |
| N,N,N',N'-tetraethyl-P-phenylphosphinediamine |
| MFCD01634466 |
| phenylphosphonous acid tetraethyldiamide |
| Phenylbis(diethylamino)phosphine |
