Introduction：Basic information about CAS 1327-79-3|Vat Blue 43, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vat Blue 43 |
|---|
| CAS Number | 1327-79-3 | Molecular Weight | 272.30100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253ºC |
|---|
Names
| Name | 4-(9H-Carbazol-3-ylimino)-2,5-cyclohexadien-1-one |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12N2O |
|---|
| Molecular Weight | 272.30100 |
|---|
| Flash Point | 253ºC |
|---|
| Exact Mass | 272.09500 |
|---|
| PSA | 45.22000 |
|---|
| LogP | 4.08870 |
|---|
| Vapour Pressure | 6.33E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | FMKXFJQAVQXMPX-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C=CC(=Nc2ccc3[nH]c4ccccc4c3c2)C=C1 |
|---|
