Introduction:Basic information about CAS 136656-49-0|[(2R,3R,4R)-3-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(2R,3R,4R)-3-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|
| CAS Number | 136656-49-0 | Molecular Weight | 344.47500 |
|---|
| Density | 1.066g/cm3 | Boiling Point | 278ºC(lit.) |
|---|
| Molecular Formula | C16H28O6Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | >230 °F |
|---|
Names
| Name | [(2R,3R,4R)-3-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.066g/cm3 |
|---|
| Boiling Point | 278ºC(lit.) |
|---|
| Molecular Formula | C16H28O6Si |
|---|
| Molecular Weight | 344.47500 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 344.16600 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 2.78410 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.458(lit.) |
|---|
| InChIKey | HSYXDFIWVSUKFT-RBSFLKMASA-N |
|---|
| SMILES | CC(=O)OC1C=COC(CO[Si](C)(C)C(C)(C)C)C1OC(C)=O |
|---|
Safety Information
Synonyms
| 2,3-di-O-acetyl-6-O-tert-butyldimethylsilyl-D-glucal |
| 3,4-di-O-acetyl-6-O-tert.butyldimethylsilyl-glucal |
| 3,4-Di-O-acetyl-6-O-(tert-butyldimethylsilyl)-D-galactal |
| 3,4-di-O-acetyl-6-O-tert-butyldimethylsilyl-D-glucal |
| MFCD01863632 |
| 3,4-di-O-acetyl-6-O-TBDMS-D-glucal |
| 3,4-di-acetyl-6-O-(tert-butyldimethylsilyl)-D-Galactal |