Introduction:Basic information about CAS 138222-00-1|(4-hydroxy-3,5-diiodophenyl)-(1H-indol-3-yl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-hydroxy-3,5-diiodophenyl)-(1H-indol-3-yl)methanone |
|---|
| CAS Number | 138222-00-1 | Molecular Weight | 489.04600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H9I2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4-hydroxy-3,5-diiodophenyl)-(1H-indol-3-yl)methanone |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H9I2NO2 |
|---|
| Molecular Weight | 489.04600 |
|---|
| Exact Mass | 488.87200 |
|---|
| PSA | 53.09000 |
|---|
| LogP | 4.31370 |
|---|
| Index of Refraction | 1.81 |
|---|
| InChIKey | RTPAVBYYXYONLJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1cc(I)c(O)c(I)c1)c1c[nH]c2ccccc12 |
|---|