Introduction:Basic information about CAS 1698-54-0|3-hydroxy-1-phenyl-6-pyridazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-hydroxy-1-phenyl-6-pyridazone |
|---|
| CAS Number | 1698-54-0 | Molecular Weight | 188.18300 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 358.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.9ºC |
|---|
Names
| Name | 2-phenyl-1H-pyridazine-3,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 358.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H8N2O2 |
|---|
| Molecular Weight | 188.18300 |
|---|
| Flash Point | 170.9ºC |
|---|
| Exact Mass | 188.05900 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 0.93810 |
|---|
| Vapour Pressure | 8.92E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | KJEBAQNNTMWJJI-UHFFFAOYSA-N |
|---|
| SMILES | O=c1ccc(=O)n(-c2ccccc2)[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-hydroxy-2-phenyl-2-hydropyridazin-3-one |
| 1-phenyl-1,2-dihydropyridazine-3,6-dione |
| 2-phenyl-1,2-dihydro-3,6-pyridazinedione |
| 6-Hydroxy-2-phenyl-3(2H)-pyridazinone |
| 6-hydroxy-2-phenylpyridazin-3(2H)-one |
| 3-HYDROXY-1-PHENYL-6-PYRIDAZONE |
| N-Phenyl-maleinsaeure-hydrazid |
| 2-Phenyl-3.6-dioxo-1.2.3.6-tetrahydro-pyridazin |
| 1-Phenyl-1,2-dihydro-pyridazin-3,6-dion |