Introduction：Basic information about CAS 39585-32-5|2-(Carboxymethyl)-4-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Carboxymethyl)-4-nitrobenzoic acid |
|---|
| CAS Number | 39585-32-5 | Molecular Weight | 225.155 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 497.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.0±14.4 °C |
|---|
Names
| Name | 2-(carboxymethyl)-4-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 497.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO6 |
|---|
| Molecular Weight | 225.155 |
|---|
| Flash Point | 221.0±14.4 °C |
|---|
| Exact Mass | 225.027344 |
|---|
| PSA | 120.42000 |
|---|
| LogP | 1.18 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | CKXXWBQEZGLFMV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1cc([N+](=O)[O-])ccc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2-carboxy-5-nitrobenzeneacetic acid |
| Benzeneacetic acid, 2-carboxy-5-nitro- |
| 4-nitrohomophthalic acid |
| RW3285 |
| 2-(Carboxymethyl)-4-nitrobenzoic acid |
