Introduction：Basic information about CAS 13665-98-0|2,3,4,5,6-pentabromoaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,6-pentabromoaniline |
|---|
| CAS Number | 13665-98-0 | Molecular Weight | 487.60700 |
|---|
| Density | 2.824g/cm3 | Boiling Point | 392.8ºC at 760mmHg |
|---|
| Molecular Formula | C6H2Br5N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.3ºC |
|---|
Names
| Name | 2,3,4,5,6-pentabromoaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.824g/cm3 |
|---|
| Boiling Point | 392.8ºC at 760mmHg |
|---|
| Molecular Formula | C6H2Br5N |
|---|
| Molecular Weight | 487.60700 |
|---|
| Flash Point | 191.3ºC |
|---|
| Exact Mass | 482.61000 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 5.66250 |
|---|
| Vapour Pressure | 2.23E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | VPFMJGCHDCVATR-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Br)c(Br)c(Br)c(Br)c1Br |
|---|
Safety Information
| Hazard Codes | Xn;Xi |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Pentabrom-anilin |
| 2,3,4,5,6-Pentabrom-anilin |
| Benzenamine,2,3,4,5,6-pentabromo |
| MFCD00092528 |
| pentabromoaniline |
| 2,3,4,5,6-pentabromo-aniline |
| Aniline,2,3,4,5,6-pentabromo |
| 2,3,4,5,6-Pentabromobenzenamine |
